C15H21IN2O2 — CID 107732198
N-[1-(aminomethyl)-2-methylcyclohexyl]-2-hydroxy-5-iodobenzamide (PubChem CID 107732198) has the molecular formula C15H21IN2O2 and a molecular weight of 388.25 g/mol. Its IUPAC name is N-[1-(aminomethyl)-2-methylcyclohexyl]-2-hydroxy-5-iodobenzamide.
| Compound Name | N-[1-(aminomethyl)-2-methylcyclohexyl]-2-hydroxy-5-iodobenzamide |
|---|---|
| PubChem CID | 107732198 |
| Molecular Formula | C15H21IN2O2 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N-[1-(aminomethyl)-2-methylcyclohexyl]-2-hydroxy-5-iodobenzamide |
| SMILES | CC1CCCCC1(CN)NC(=O)c1cc(I)ccc1O |
| InChI | InChI=1S/C15H21IN2O2/c1-10-4-2-3-7-15(10,9-17)18-14(20)12-8-11(16)5-6-13(12)19/h5-6,8,10,19H,2-4,7,9,17H2,1H3,(H,18,20) |
| InChIKey | SIIBZUZOQUYHRI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|