C21H26N2O3S — CID 11531144
3,5-ditert-butyl-N-(4-cyanophenyl)-2-hydroxybenzenesulfonamide (PubChem CID 11531144) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-(4-cyanophenyl)-2-hydroxybenzenesulfonamide.
| Compound Name | 3,5-ditert-butyl-N-(4-cyanophenyl)-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 11531144 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3,5-ditert-butyl-N-(4-cyanophenyl)-2-hydroxybenzenesulfonamide |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(O)c(S(=O)(=O)Nc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C21H26N2O3S/c1-20(2,3)15-11-17(21(4,5)6)19(24)18(12-15)27(25,26)23-16-9-7-14(13-22)8-10-16/h7-12,23-24H,1-6H3 |
| InChIKey | MLTPJMBACKHPTF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |