C16H23N3 — CID 115311556
[1-[(1-ethylindol-3-yl)methyl]pyrrolidin-2-yl]methanamine (PubChem CID 115311556) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is [1-[(1-ethylindol-3-yl)methyl]pyrrolidin-2-yl]methanamine.
| Compound Name | [1-[(1-ethylindol-3-yl)methyl]pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 115311556 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | [1-[(1-ethylindol-3-yl)methyl]pyrrolidin-2-yl]methanamine |
| SMILES | CCn1cc(CN2CCCC2CN)c2ccccc21 |
| InChI | InChI=1S/C16H23N3/c1-2-18-11-13(15-7-3-4-8-16(15)18)12-19-9-5-6-14(19)10-17/h3-4,7-8,11,14H,2,5-6,9-10,12,17H2,1H3 |
| InChIKey | OWFQCOGMQVYEIQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |