C13H24N2 — CID 115313678
3-cyclohexyl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 115313678) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 3-cyclohexyl-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-cyclohexyl-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 115313678 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 3-cyclohexyl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | C1CCC(N2CCC3CCC(C2)N3)CC1 |
| InChI | InChI=1S/C13H24N2/c1-2-4-13(5-3-1)15-9-8-11-6-7-12(10-15)14-11/h11-14H,1-10H2 |
| InChIKey | CTMRLVAOXBORFK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |