methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate

C11H20N2O2 — CID 115314462

IUPACmethyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate
SMILESCOC(=O)C(C)N1CCC2CCC(C1)N2
InChIInChI=1S/C11H20N2O2/c1-8(11(14)15-2)13-6-5-9-3-4-10(7-13)12-9/h8-10,12H,3-7H2,1-2H3
InChIKeyLHOXIFRWSVZPLT-UHFFFAOYSA-N
MW212.29 g/mol
LogP0.37
Rot. Bonds2

About methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate

methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate (PubChem CID 115314462) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate
PubChem CID115314462
Molecular FormulaC11H20N2O2
Molecular Weight212.29 g/mol
Exact Mass212.15
IUPAC Namemethyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate
SMILESCOC(=O)C(C)N1CCC2CCC(C1)N2
InChIInChI=1S/C11H20N2O2/c1-8(11(14)15-2)13-6-5-9-3-4-10(7-13)12-9/h8-10,12H,3-7H2,1-2H3
InChIKeyLHOXIFRWSVZPLT-UHFFFAOYSA-N
XLogP0.37
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.29
LogP ≤ 50.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate?
The IUPAC name of methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate (CID 115314462) is methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate.
What is the SMILES notation for methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate?
The canonical SMILES for methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate is COC(=O)C(C)N1CCC2CCC(C1)N2.
What is the InChIKey of methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate?
The InChIKey is LHOXIFRWSVZPLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-8(11(14)15-2)13-6-5-9-3-4-10(7-13)12-9/h8-10,12H,3-7H2,1-2H3.
What are the key properties of methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate?
methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate has a molecular weight of 212.29 g/mol, XLogP of 0.37, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,9-diazabicyclo[4.2.1]nonan-3-yl)propanoate is sourced from PubChem (CID 115314462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).