C9H15N5O3 — CID 115315777
6-[2-(1-aminoethyl)morpholin-4-yl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 115315777) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 6-[2-(1-aminoethyl)morpholin-4-yl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[2-(1-aminoethyl)morpholin-4-yl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 115315777 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 6-[2-(1-aminoethyl)morpholin-4-yl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | CC(N)C1CN(c2n[nH]c(=O)[nH]c2=O)CCO1 |
| InChI | InChI=1S/C9H15N5O3/c1-5(10)6-4-14(2-3-17-6)7-8(15)11-9(16)13-12-7/h5-6H,2-4,10H2,1H3,(H2,11,13,15,16) |
| InChIKey | OHYZUOITSFQMDU-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |