C7H10N4O3 — CID 103646748
6-[(3R)-3-hydroxypyrrolidin-1-yl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 103646748) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is 6-[(3R)-3-hydroxypyrrolidin-1-yl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(3R)-3-hydroxypyrrolidin-1-yl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 103646748 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 6-[(3R)-3-hydroxypyrrolidin-1-yl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(N2CC[C@@H](O)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C7H10N4O3/c12-4-1-2-11(3-4)5-6(13)8-7(14)10-9-5/h4,12H,1-3H2,(H2,8,10,13,14)/t4-/m1/s1 |
| InChIKey | CAIHIMCBBMQKHS-SCSAIBSYSA-N |
| XLogP | -1.97 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |