C9H10F3N3O2 — CID 167228912
3-[(3S)-3-hydroxypyrrolidin-1-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 167228912) has the molecular formula C9H10F3N3O2 and a molecular weight of 249.19 g/mol. Its IUPAC name is 3-[(3S)-3-hydroxypyrrolidin-1-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 3-[(3S)-3-hydroxypyrrolidin-1-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 167228912 |
| Molecular Formula | C9H10F3N3O2 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 3-[(3S)-3-hydroxypyrrolidin-1-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | O=c1[nH]nc(N2CC[C@H](O)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C9H10F3N3O2/c10-9(11,12)6-3-7(13-14-8(6)17)15-2-1-5(16)4-15/h3,5,16H,1-2,4H2,(H,14,17)/t5-/m0/s1 |
| InChIKey | DHEMVOUMQGYFHG-YFKPBYRVSA-N |
| XLogP | 0.36 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |