C10H16N6O2 — CID 66196209
6-(3-piperazin-1-ylazetidin-1-yl)-2H-1,2,4-triazine-3,5-dione (PubChem CID 66196209) has the molecular formula C10H16N6O2 and a molecular weight of 252.28 g/mol. Its IUPAC name is 6-(3-piperazin-1-ylazetidin-1-yl)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(3-piperazin-1-ylazetidin-1-yl)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 66196209 |
| Molecular Formula | C10H16N6O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 6-(3-piperazin-1-ylazetidin-1-yl)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(N2CC(N3CCNCC3)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H16N6O2/c17-9-8(13-14-10(18)12-9)16-5-7(6-16)15-3-1-11-2-4-15/h7,11H,1-6H2,(H2,12,14,17,18) |
| InChIKey | SDZHAHFYTBAURE-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |