C9H15N5S — CID 66196214
5-(3-piperazin-1-ylazetidin-1-yl)-1,2,4-thiadiazole (PubChem CID 66196214) has the molecular formula C9H15N5S and a molecular weight of 225.32 g/mol. Its IUPAC name is 5-(3-piperazin-1-ylazetidin-1-yl)-1,2,4-thiadiazole.
| Compound Name | 5-(3-piperazin-1-ylazetidin-1-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 66196214 |
| Molecular Formula | C9H15N5S |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 5-(3-piperazin-1-ylazetidin-1-yl)-1,2,4-thiadiazole |
| SMILES | c1nsc(N2CC(N3CCNCC3)C2)n1 |
| InChI | InChI=1S/C9H15N5S/c1-3-13(4-2-10-1)8-5-14(6-8)9-11-7-12-15-9/h7-8,10H,1-6H2 |
| InChIKey | XOBNYPXFEONFBC-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |