C9H15N3S — CID 89385947
5-(3,5-dimethylpiperidin-1-yl)-1,2,4-thiadiazole (PubChem CID 89385947) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 5-(3,5-dimethylpiperidin-1-yl)-1,2,4-thiadiazole.
| Compound Name | 5-(3,5-dimethylpiperidin-1-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 89385947 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 5-(3,5-dimethylpiperidin-1-yl)-1,2,4-thiadiazole |
| SMILES | CC1CC(C)CN(c2ncns2)C1 |
| InChI | InChI=1S/C9H15N3S/c1-7-3-8(2)5-12(4-7)9-10-6-11-13-9/h6-8H,3-5H2,1-2H3 |
| InChIKey | SEJZXMYRGJPEEX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |