C7H12N4S — CID 104976155
5-[(3R)-3-methylpiperazin-1-yl]-1,2,4-thiadiazole (PubChem CID 104976155) has the molecular formula C7H12N4S and a molecular weight of 184.27 g/mol. Its IUPAC name is 5-[(3R)-3-methylpiperazin-1-yl]-1,2,4-thiadiazole.
| Compound Name | 5-[(3R)-3-methylpiperazin-1-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 104976155 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 5-[(3R)-3-methylpiperazin-1-yl]-1,2,4-thiadiazole |
| SMILES | C[C@@H]1CN(c2ncns2)CCN1 |
| InChI | InChI=1S/C7H12N4S/c1-6-4-11(3-2-8-6)7-9-5-10-12-7/h5-6,8H,2-4H2,1H3/t6-/m1/s1 |
| InChIKey | SOVZSLKCOOGKAT-ZCFIWIBFSA-N |
| XLogP | 0.34 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |