C7H10ClN3S — CID 65277685
5-(4-chloropiperidin-1-yl)-1,2,4-thiadiazole (PubChem CID 65277685) has the molecular formula C7H10ClN3S and a molecular weight of 203.70 g/mol. Its IUPAC name is 5-(4-chloropiperidin-1-yl)-1,2,4-thiadiazole.
| Compound Name | 5-(4-chloropiperidin-1-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 65277685 |
| Molecular Formula | C7H10ClN3S |
| Molecular Weight | 203.70 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 5-(4-chloropiperidin-1-yl)-1,2,4-thiadiazole |
| SMILES | ClC1CCN(c2ncns2)CC1 |
| InChI | InChI=1S/C7H10ClN3S/c8-6-1-3-11(4-2-6)7-9-5-10-12-7/h5-6H,1-4H2 |
| InChIKey | NFLRJOSGMSBUEQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|