C14H16F3N3O — CID 115315825
4-[2-(1-aminoethyl)morpholin-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 115315825) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 4-[2-(1-aminoethyl)morpholin-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[2-(1-aminoethyl)morpholin-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115315825 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-[2-(1-aminoethyl)morpholin-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC(N)C1CN(c2ccc(C#N)c(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C14H16F3N3O/c1-9(19)13-8-20(4-5-21-13)11-3-2-10(7-18)12(6-11)14(15,16)17/h2-3,6,9,13H,4-5,8,19H2,1H3 |
| InChIKey | PVEAUWZQUJHITD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |