C13H20N4O2 — CID 115316691
N-[2-[2-(methylaminomethyl)pyrrolidin-1-yl]acetyl]-1H-pyrrole-2-carboxamide (PubChem CID 115316691) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-[2-[2-(methylaminomethyl)pyrrolidin-1-yl]acetyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[2-[2-(methylaminomethyl)pyrrolidin-1-yl]acetyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 115316691 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-[2-[2-(methylaminomethyl)pyrrolidin-1-yl]acetyl]-1H-pyrrole-2-carboxamide |
| SMILES | CNCC1CCCN1CC(=O)NC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C13H20N4O2/c1-14-8-10-4-3-7-17(10)9-12(18)16-13(19)11-5-2-6-15-11/h2,5-6,10,14-15H,3-4,7-9H2,1H3,(H,16,18,19) |
| InChIKey | IDNACFJYMVUEDV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |