C11H18ClN3O — CID 119649627
[2-(methylaminomethyl)pyrrolidin-1-yl]-(1H-pyrrol-2-yl)methanone;hydrochloride (PubChem CID 119649627) has the molecular formula C11H18ClN3O and a molecular weight of 243.74 g/mol. Its IUPAC name is [2-(methylaminomethyl)pyrrolidin-1-yl]-(1H-pyrrol-2-yl)methanone;hydrochloride.
| Compound Name | [2-(methylaminomethyl)pyrrolidin-1-yl]-(1H-pyrrol-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119649627 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | [2-(methylaminomethyl)pyrrolidin-1-yl]-(1H-pyrrol-2-yl)methanone;hydrochloride |
| SMILES | CNCC1CCCN1C(=O)c1ccc[nH]1.Cl |
| InChI | InChI=1S/C11H17N3O.ClH/c1-12-8-9-4-3-7-14(9)11(15)10-5-2-6-13-10;/h2,5-6,9,12-13H,3-4,7-8H2,1H3;1H |
| InChIKey | NZGCNFIOOJNMMM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |