About 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine
1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine (PubChem CID 115318267) has the molecular formula C14H27N5O2
and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine.
Molecular Properties
| Compound Name | 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine |
| PubChem CID | 115318267 |
| Molecular Formula | C14H27N5O2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine |
| SMILES | CC(C)c1nn(C)c(N(C)CCC(N)C(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H27N5O2/c1-9(2)11(15)7-8-17(5)14-13(19(20)21)12(10(3)4)16-18(14)6/h9-11H,7-8,15H2,1-6H3 |
| InChIKey | OJLUCTGFJYWOCT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine?
The IUPAC name of 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine (CID 115318267) is 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine.
What is the SMILES notation for 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine?
The canonical SMILES for 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine is CC(C)c1nn(C)c(N(C)CCC(N)C(C)C)c1[N+](=O)[O-].
What is the InChIKey of 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine?
The InChIKey is OJLUCTGFJYWOCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N5O2/c1-9(2)11(15)7-8-17(5)14-13(19(20)21)12(10(3)4)16-18(14)6/h9-11H,7-8,15H2,1-6H3.
What are the key properties of 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine?
1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine has a molecular weight of 297.40 g/mol, XLogP of 2.26, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine is sourced from PubChem (CID 115318267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).