C14H27N5O2 — CID 115318267
1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine (PubChem CID 115318267) has the molecular formula C14H27N5O2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine.
| Compound Name | 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine |
|---|---|
| PubChem CID | 115318267 |
| Molecular Formula | C14H27N5O2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 1-N,4-dimethyl-1-N-(1-methyl-4-nitro-3-propan-2-ylpyrazol-5-yl)pentane-1,3-diamine |
| SMILES | CC(C)c1nn(C)c(N(C)CCC(N)C(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H27N5O2/c1-9(2)11(15)7-8-17(5)14-13(19(20)21)12(10(3)4)16-18(14)6/h9-11H,7-8,15H2,1-6H3 |
| InChIKey | OJLUCTGFJYWOCT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|