C11H10BrNOS — CID 115318324
2-[(4-bromo-3-methylphenoxy)methyl]-1,3-thiazole (PubChem CID 115318324) has the molecular formula C11H10BrNOS and a molecular weight of 284.18 g/mol. Its IUPAC name is 2-[(4-bromo-3-methylphenoxy)methyl]-1,3-thiazole.
| Compound Name | 2-[(4-bromo-3-methylphenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 115318324 |
| Molecular Formula | C11H10BrNOS |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | 2-[(4-bromo-3-methylphenoxy)methyl]-1,3-thiazole |
| SMILES | Cc1cc(OCc2nccs2)ccc1Br |
| InChI | InChI=1S/C11H10BrNOS/c1-8-6-9(2-3-10(8)12)14-7-11-13-4-5-15-11/h2-6H,7H2,1H3 |
| InChIKey | OHDDTJXKKHCQBH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |