C10H16N2O3 — CID 115319208
2-[[3-aminopropyl(methyl)amino]methyl]-5-hydroxypyran-4-one (PubChem CID 115319208) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[[3-aminopropyl(methyl)amino]methyl]-5-hydroxypyran-4-one.
| Compound Name | 2-[[3-aminopropyl(methyl)amino]methyl]-5-hydroxypyran-4-one |
|---|---|
| PubChem CID | 115319208 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-[[3-aminopropyl(methyl)amino]methyl]-5-hydroxypyran-4-one |
| SMILES | CN(CCCN)Cc1cc(=O)c(O)co1 |
| InChI | InChI=1S/C10H16N2O3/c1-12(4-2-3-11)6-8-5-9(13)10(14)7-15-8/h5,7,14H,2-4,6,11H2,1H3 |
| InChIKey | DBPMLKQNURKIMU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |