C22H13ClF2N2OS — CID 11531993
3-[5-chloro-4-[(3,4-difluorophenyl)methyl]-2-sulfanylidene-1,4-dihydro-3,1-benzoxazin-6-yl]benzonitrile (PubChem CID 11531993) has the molecular formula C22H13ClF2N2OS and a molecular weight of 426.88 g/mol. Its IUPAC name is 3-[5-chloro-4-[(3,4-difluorophenyl)methyl]-2-sulfanylidene-1,4-dihydro-3,1-benzoxazin-6-yl]benzonitrile.
| Compound Name | 3-[5-chloro-4-[(3,4-difluorophenyl)methyl]-2-sulfanylidene-1,4-dihydro-3,1-benzoxazin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 11531993 |
| Molecular Formula | C22H13ClF2N2OS |
| Molecular Weight | 426.88 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 3-[5-chloro-4-[(3,4-difluorophenyl)methyl]-2-sulfanylidene-1,4-dihydro-3,1-benzoxazin-6-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc3c(c2Cl)C(Cc2ccc(F)c(F)c2)OC(=S)N3)c1 |
| InChI | InChI=1S/C22H13ClF2N2OS/c23-21-15(14-3-1-2-13(8-14)11-26)5-7-18-20(21)19(28-22(29)27-18)10-12-4-6-16(24)17(25)9-12/h1-9,19H,10H2,(H,27,29) |
| InChIKey | IULLXBYHCBCZFQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.88 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|