C27H21N3O3 — CID 11532165
2-[3-[(E)-3-(N-benzylanilino)-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetic acid (PubChem CID 11532165) has the molecular formula C27H21N3O3 and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-[3-[(E)-3-(N-benzylanilino)-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[(E)-3-(N-benzylanilino)-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 11532165 |
| Molecular Formula | C27H21N3O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 2-[3-[(E)-3-(N-benzylanilino)-2-cyano-3-oxoprop-1-enyl]indol-1-yl]acetic acid |
| SMILES | N#C/C(=C\c1cn(CC(=O)O)c2ccccc12)C(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H21N3O3/c28-16-21(15-22-18-29(19-26(31)32)25-14-8-7-13-24(22)25)27(33)30(23-11-5-2-6-12-23)17-20-9-3-1-4-10-20/h1-15,18H,17,19H2,(H,31,32)/b21-15+ |
| InChIKey | RITHQVLBROTCDZ-RCCKNPSSSA-N |
| XLogP | 4.87 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|