C13H9F3N4O — CID 115322381
5-methoxy-3-(2,3,5-trifluorophenyl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 115322381) has the molecular formula C13H9F3N4O and a molecular weight of 294.24 g/mol. Its IUPAC name is 5-methoxy-3-(2,3,5-trifluorophenyl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 5-methoxy-3-(2,3,5-trifluorophenyl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 115322381 |
| Molecular Formula | C13H9F3N4O |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 5-methoxy-3-(2,3,5-trifluorophenyl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | COc1ccc2nc(N)n(-c3cc(F)cc(F)c3F)c2n1 |
| InChI | InChI=1S/C13H9F3N4O/c1-21-10-3-2-8-12(19-10)20(13(17)18-8)9-5-6(14)4-7(15)11(9)16/h2-5H,1H3,(H2,17,18) |
| InChIKey | JNIPGPWPPPGVAW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|