C13H7ClF3N3 — CID 115470604
6-chloro-1-(2,3,5-trifluorophenyl)benzimidazol-2-amine (PubChem CID 115470604) has the molecular formula C13H7ClF3N3 and a molecular weight of 297.67 g/mol. Its IUPAC name is 6-chloro-1-(2,3,5-trifluorophenyl)benzimidazol-2-amine.
| Compound Name | 6-chloro-1-(2,3,5-trifluorophenyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 115470604 |
| Molecular Formula | C13H7ClF3N3 |
| Molecular Weight | 297.67 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 6-chloro-1-(2,3,5-trifluorophenyl)benzimidazol-2-amine |
| SMILES | Nc1nc2ccc(Cl)cc2n1-c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C13H7ClF3N3/c14-6-1-2-9-10(3-6)20(13(18)19-9)11-5-7(15)4-8(16)12(11)17/h1-5H,(H2,18,19) |
| InChIKey | JZFRWDWPOWPHLV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.67 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|