C14H19ClN4O2 — CID 115322847
2-[2-(chloromethyl)-5-methoxyimidazo[4,5-b]pyridin-3-yl]-N-propylpropanamide (PubChem CID 115322847) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.79 g/mol. Its IUPAC name is 2-[2-(chloromethyl)-5-methoxyimidazo[4,5-b]pyridin-3-yl]-N-propylpropanamide.
| Compound Name | 2-[2-(chloromethyl)-5-methoxyimidazo[4,5-b]pyridin-3-yl]-N-propylpropanamide |
|---|---|
| PubChem CID | 115322847 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[2-(chloromethyl)-5-methoxyimidazo[4,5-b]pyridin-3-yl]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)n1c(CCl)nc2ccc(OC)nc21 |
| InChI | InChI=1S/C14H19ClN4O2/c1-4-7-16-14(20)9(2)19-11(8-15)17-10-5-6-12(21-3)18-13(10)19/h5-6,9H,4,7-8H2,1-3H3,(H,16,20) |
| InChIKey | DCOCWFPUSKWKGH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|