C12H16ClN3O3S — CID 115323110
2-(chloromethyl)-5-methoxy-3-(1-methylsulfonylpropan-2-yl)imidazo[4,5-b]pyridine (PubChem CID 115323110) has the molecular formula C12H16ClN3O3S and a molecular weight of 317.80 g/mol. Its IUPAC name is 2-(chloromethyl)-5-methoxy-3-(1-methylsulfonylpropan-2-yl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(chloromethyl)-5-methoxy-3-(1-methylsulfonylpropan-2-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 115323110 |
| Molecular Formula | C12H16ClN3O3S |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-(chloromethyl)-5-methoxy-3-(1-methylsulfonylpropan-2-yl)imidazo[4,5-b]pyridine |
| SMILES | COc1ccc2nc(CCl)n(C(C)CS(C)(=O)=O)c2n1 |
| InChI | InChI=1S/C12H16ClN3O3S/c1-8(7-20(3,17)18)16-10(6-13)14-9-4-5-11(19-2)15-12(9)16/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | ULJNRQCGDQYQCS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|