C23H23NO4S2 — CID 11532289
5-[[4-[(4-ethylphenyl)methylsulfanyl]phenyl]sulfamoyl]-2-methylbenzoic acid (PubChem CID 11532289) has the molecular formula C23H23NO4S2 and a molecular weight of 441.57 g/mol. Its IUPAC name is 5-[[4-[(4-ethylphenyl)methylsulfanyl]phenyl]sulfamoyl]-2-methylbenzoic acid.
| Compound Name | 5-[[4-[(4-ethylphenyl)methylsulfanyl]phenyl]sulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 11532289 |
| Molecular Formula | C23H23NO4S2 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 5-[[4-[(4-ethylphenyl)methylsulfanyl]phenyl]sulfamoyl]-2-methylbenzoic acid |
| SMILES | CCc1ccc(CSc2ccc(NS(=O)(=O)c3ccc(C)c(C(=O)O)c3)cc2)cc1 |
| InChI | InChI=1S/C23H23NO4S2/c1-3-17-5-7-18(8-6-17)15-29-20-11-9-19(10-12-20)24-30(27,28)21-13-4-16(2)22(14-21)23(25)26/h4-14,24H,3,15H2,1-2H3,(H,25,26) |
| InChIKey | VRAPCAZHERPDQO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |