C27H29NO4S2 — CID 122622711
2-[(4-cyclohexylphenyl)sulfonylamino]-5-(2-phenylethylsulfanyl)benzoic acid (PubChem CID 122622711) has the molecular formula C27H29NO4S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is 2-[(4-cyclohexylphenyl)sulfonylamino]-5-(2-phenylethylsulfanyl)benzoic acid.
| Compound Name | 2-[(4-cyclohexylphenyl)sulfonylamino]-5-(2-phenylethylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 122622711 |
| Molecular Formula | C27H29NO4S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 2-[(4-cyclohexylphenyl)sulfonylamino]-5-(2-phenylethylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1cc(SCCc2ccccc2)ccc1NS(=O)(=O)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C27H29NO4S2/c29-27(30)25-19-23(33-18-17-20-7-3-1-4-8-20)13-16-26(25)28-34(31,32)24-14-11-22(12-15-24)21-9-5-2-6-10-21/h1,3-4,7-8,11-16,19,21,28H,2,5-6,9-10,17-18H2,(H,29,30) |
| InChIKey | AFQRCYMVRHWZKV-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |