C14H22Cl2N2O2S — CID 115327509
5-(aminomethyl)-2,4-dichloro-N-(5-methylhexyl)benzenesulfonamide (PubChem CID 115327509) has the molecular formula C14H22Cl2N2O2S and a molecular weight of 353.32 g/mol. Its IUPAC name is 5-(aminomethyl)-2,4-dichloro-N-(5-methylhexyl)benzenesulfonamide.
| Compound Name | 5-(aminomethyl)-2,4-dichloro-N-(5-methylhexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115327509 |
| Molecular Formula | C14H22Cl2N2O2S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 5-(aminomethyl)-2,4-dichloro-N-(5-methylhexyl)benzenesulfonamide |
| SMILES | CC(C)CCCCNS(=O)(=O)c1cc(CN)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H22Cl2N2O2S/c1-10(2)5-3-4-6-18-21(19,20)14-7-11(9-17)12(15)8-13(14)16/h7-8,10,18H,3-6,9,17H2,1-2H3 |
| InChIKey | PSEUYFDPONHEQJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|