C12H18Cl2N2O2S — CID 106058220
5-(aminomethyl)-2,4-dichloro-N-pentylbenzenesulfonamide (PubChem CID 106058220) has the molecular formula C12H18Cl2N2O2S and a molecular weight of 325.26 g/mol. Its IUPAC name is 5-(aminomethyl)-2,4-dichloro-N-pentylbenzenesulfonamide.
| Compound Name | 5-(aminomethyl)-2,4-dichloro-N-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 106058220 |
| Molecular Formula | C12H18Cl2N2O2S |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 5-(aminomethyl)-2,4-dichloro-N-pentylbenzenesulfonamide |
| SMILES | CCCCCNS(=O)(=O)c1cc(CN)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H18Cl2N2O2S/c1-2-3-4-5-16-19(17,18)12-6-9(8-15)10(13)7-11(12)14/h6-7,16H,2-5,8,15H2,1H3 |
| InChIKey | NBZPMMDYFFHIOI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|