C18H26N2 — CID 115328459
1-(2-phenylprop-2-enyl)-3-pyrrolidin-2-ylpiperidine (PubChem CID 115328459) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-(2-phenylprop-2-enyl)-3-pyrrolidin-2-ylpiperidine.
| Compound Name | 1-(2-phenylprop-2-enyl)-3-pyrrolidin-2-ylpiperidine |
|---|---|
| PubChem CID | 115328459 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 1-(2-phenylprop-2-enyl)-3-pyrrolidin-2-ylpiperidine |
| SMILES | C=C(CN1CCCC(C2CCCN2)C1)c1ccccc1 |
| InChI | InChI=1S/C18H26N2/c1-15(16-7-3-2-4-8-16)13-20-12-6-9-17(14-20)18-10-5-11-19-18/h2-4,7-8,17-19H,1,5-6,9-14H2 |
| InChIKey | ABMDHSKSVFLCTA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |