C15H23BrN2O2S — CID 115329664
3-amino-4-bromo-N-(4,4-dimethylcyclohexyl)-N-methylbenzenesulfonamide (PubChem CID 115329664) has the molecular formula C15H23BrN2O2S and a molecular weight of 375.33 g/mol. Its IUPAC name is 3-amino-4-bromo-N-(4,4-dimethylcyclohexyl)-N-methylbenzenesulfonamide.
| Compound Name | 3-amino-4-bromo-N-(4,4-dimethylcyclohexyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 115329664 |
| Molecular Formula | C15H23BrN2O2S |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 3-amino-4-bromo-N-(4,4-dimethylcyclohexyl)-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCC(C)(C)CC1)S(=O)(=O)c1ccc(Br)c(N)c1 |
| InChI | InChI=1S/C15H23BrN2O2S/c1-15(2)8-6-11(7-9-15)18(3)21(19,20)12-4-5-13(16)14(17)10-12/h4-5,10-11H,6-9,17H2,1-3H3 |
| InChIKey | RLSHUBSEYGZPIH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|