C11H19N5O2 — CID 115330529
5-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-ethyl-1-methylpyrazole-4-carboxamide (PubChem CID 115330529) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 5-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-ethyl-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-ethyl-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 115330529 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 5-amino-N-[2-(dimethylamino)-2-oxoethyl]-N-ethyl-1-methylpyrazole-4-carboxamide |
| SMILES | CCN(CC(=O)N(C)C)C(=O)c1cnn(C)c1N |
| InChI | InChI=1S/C11H19N5O2/c1-5-16(7-9(17)14(2)3)11(18)8-6-13-15(4)10(8)12/h6H,5,7,12H2,1-4H3 |
| InChIKey | AXQKZKBJYCRKFW-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |