C13H18N2OS — CID 115332722
1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)cycloheptan-1-ol (PubChem CID 115332722) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)cycloheptan-1-ol.
| Compound Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 115332722 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)cycloheptan-1-ol |
| SMILES | OC1(Cc2cn3ccsc3n2)CCCCCC1 |
| InChI | InChI=1S/C13H18N2OS/c16-13(5-3-1-2-4-6-13)9-11-10-15-7-8-17-12(15)14-11/h7-8,10,16H,1-6,9H2 |
| InChIKey | DHXSSOQZMUINOP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |