C11H15N3OS — CID 115332763
4-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)piperidin-4-ol (PubChem CID 115332763) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 4-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)piperidin-4-ol.
| Compound Name | 4-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 115332763 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)piperidin-4-ol |
| SMILES | OC1(Cc2cn3ccsc3n2)CCNCC1 |
| InChI | InChI=1S/C11H15N3OS/c15-11(1-3-12-4-2-11)7-9-8-14-5-6-16-10(14)13-9/h5-6,8,12,15H,1-4,7H2 |
| InChIKey | MUVZHLJTLGXCQD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |