C12H13N5O2S — CID 115334218
3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 115334218) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is 3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 115334218 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCNC2)C(=O)N1Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C12H13N5O2S/c18-9-12(1-2-13-7-12)15-10(19)17(9)6-8-5-16-3-4-20-11(16)14-8/h3-5,13H,1-2,6-7H2,(H,15,19) |
| InChIKey | XOAZROOXBOYEQX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|