C14H21N3OS — CID 115334368
N-[[3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)oxolan-3-yl]methyl]propan-1-amine (PubChem CID 115334368) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is N-[[3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)oxolan-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)oxolan-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 115334368 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N-[[3-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)oxolan-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1(Cc2cn3ccsc3n2)CCOC1 |
| InChI | InChI=1S/C14H21N3OS/c1-2-4-15-10-14(3-6-18-11-14)8-12-9-17-5-7-19-13(17)16-12/h5,7,9,15H,2-4,6,8,10-11H2,1H3 |
| InChIKey | IAINXFVQSZYFMO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|