C14H20N2O3S — CID 116754112
1-(4-ethoxyoxan-4-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol (PubChem CID 116754112) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 1-(4-ethoxyoxan-4-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol.
| Compound Name | 1-(4-ethoxyoxan-4-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol |
|---|---|
| PubChem CID | 116754112 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 1-(4-ethoxyoxan-4-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol |
| SMILES | CCOC1(C(O)Cc2cn3ccsc3n2)CCOCC1 |
| InChI | InChI=1S/C14H20N2O3S/c1-2-19-14(3-6-18-7-4-14)12(17)9-11-10-16-5-8-20-13(16)15-11/h5,8,10,12,17H,2-4,6-7,9H2,1H3 |
| InChIKey | YXFNPIINYONZEF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |