C16H17ClN2S — CID 115335168
6-[2-(chloromethyl)-3-(3-methylphenyl)propyl]imidazo[2,1-b][1,3]thiazole (PubChem CID 115335168) has the molecular formula C16H17ClN2S and a molecular weight of 304.85 g/mol. Its IUPAC name is 6-[2-(chloromethyl)-3-(3-methylphenyl)propyl]imidazo[2,1-b][1,3]thiazole.
| Compound Name | 6-[2-(chloromethyl)-3-(3-methylphenyl)propyl]imidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 115335168 |
| Molecular Formula | C16H17ClN2S |
| Molecular Weight | 304.85 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 6-[2-(chloromethyl)-3-(3-methylphenyl)propyl]imidazo[2,1-b][1,3]thiazole |
| SMILES | Cc1cccc(CC(CCl)Cc2cn3ccsc3n2)c1 |
| InChI | InChI=1S/C16H17ClN2S/c1-12-3-2-4-13(7-12)8-14(10-17)9-15-11-19-5-6-20-16(19)18-15/h2-7,11,14H,8-10H2,1H3 |
| InChIKey | PPESVOYGKCGBEE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|