C11H19N3O2S — CID 115336541
(1,1-dioxothiolan-3-yl)-(1-propylpyrazol-4-yl)methanamine (PubChem CID 115336541) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(1-propylpyrazol-4-yl)methanamine.
| Compound Name | (1,1-dioxothiolan-3-yl)-(1-propylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 115336541 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(1-propylpyrazol-4-yl)methanamine |
| SMILES | CCCn1cc(C(N)C2CCS(=O)(=O)C2)cn1 |
| InChI | InChI=1S/C11H19N3O2S/c1-2-4-14-7-10(6-13-14)11(12)9-3-5-17(15,16)8-9/h6-7,9,11H,2-5,8,12H2,1H3 |
| InChIKey | QMHNFDXQBOQPBI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |