C8H12N2O2S2 — CID 164648502
(1,1-dioxothiolan-3-yl)-(1,2-thiazol-4-yl)methanamine (PubChem CID 164648502) has the molecular formula C8H12N2O2S2 and a molecular weight of 232.33 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(1,2-thiazol-4-yl)methanamine.
| Compound Name | (1,1-dioxothiolan-3-yl)-(1,2-thiazol-4-yl)methanamine |
|---|---|
| PubChem CID | 164648502 |
| Molecular Formula | C8H12N2O2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(1,2-thiazol-4-yl)methanamine |
| SMILES | NC(c1cnsc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H12N2O2S2/c9-8(7-3-10-13-4-7)6-1-2-14(11,12)5-6/h3-4,6,8H,1-2,5,9H2 |
| InChIKey | LIGIGNFXOHIULJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |