C14H16N2O2S — CID 115336525
(1,1-dioxothiolan-3-yl)-quinolin-3-ylmethanamine (PubChem CID 115336525) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-quinolin-3-ylmethanamine.
| Compound Name | (1,1-dioxothiolan-3-yl)-quinolin-3-ylmethanamine |
|---|---|
| PubChem CID | 115336525 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-quinolin-3-ylmethanamine |
| SMILES | NC(c1cnc2ccccc2c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16N2O2S/c15-14(11-5-6-19(17,18)9-11)12-7-10-3-1-2-4-13(10)16-8-12/h1-4,7-8,11,14H,5-6,9,15H2 |
| InChIKey | FLLUFEOCYRJNHZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |