C16H20N2S2 — CID 115387663
(3-ethyl-1,4-dithian-2-yl)-quinolin-3-ylmethanamine (PubChem CID 115387663) has the molecular formula C16H20N2S2 and a molecular weight of 304.48 g/mol. Its IUPAC name is (3-ethyl-1,4-dithian-2-yl)-quinolin-3-ylmethanamine.
| Compound Name | (3-ethyl-1,4-dithian-2-yl)-quinolin-3-ylmethanamine |
|---|---|
| PubChem CID | 115387663 |
| Molecular Formula | C16H20N2S2 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (3-ethyl-1,4-dithian-2-yl)-quinolin-3-ylmethanamine |
| SMILES | CCC1SCCSC1C(N)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C16H20N2S2/c1-2-14-16(20-8-7-19-14)15(17)12-9-11-5-3-4-6-13(11)18-10-12/h3-6,9-10,14-16H,2,7-8,17H2,1H3 |
| InChIKey | SXGMHCGBEAFUDN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |