C16H18F2N2 — CID 105097828
(4,4-difluorocyclohexyl)-quinolin-3-ylmethanamine (PubChem CID 105097828) has the molecular formula C16H18F2N2 and a molecular weight of 276.33 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-quinolin-3-ylmethanamine.
| Compound Name | (4,4-difluorocyclohexyl)-quinolin-3-ylmethanamine |
|---|---|
| PubChem CID | 105097828 |
| Molecular Formula | C16H18F2N2 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (4,4-difluorocyclohexyl)-quinolin-3-ylmethanamine |
| SMILES | NC(c1cnc2ccccc2c1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C16H18F2N2/c17-16(18)7-5-11(6-8-16)15(19)13-9-12-3-1-2-4-14(12)20-10-13/h1-4,9-11,15H,5-8,19H2 |
| InChIKey | CJOXLJPTCYSNQV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |