C14H23N3O2S — CID 115337065
4-[2-(1,1-dioxothiolan-3-yl)-2-(propylamino)ethyl]pyridin-2-amine (PubChem CID 115337065) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 4-[2-(1,1-dioxothiolan-3-yl)-2-(propylamino)ethyl]pyridin-2-amine.
| Compound Name | 4-[2-(1,1-dioxothiolan-3-yl)-2-(propylamino)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 115337065 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-[2-(1,1-dioxothiolan-3-yl)-2-(propylamino)ethyl]pyridin-2-amine |
| SMILES | CCCNC(Cc1ccnc(N)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H23N3O2S/c1-2-5-16-13(12-4-7-20(18,19)10-12)8-11-3-6-17-14(15)9-11/h3,6,9,12-13,16H,2,4-5,7-8,10H2,1H3,(H2,15,17) |
| InChIKey | BSBPEBYSNWVBBM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |