C11H13NO2S2 — CID 115337642
1,1-dioxo-3-(2-thiophen-3-ylethyl)thiolane-3-carbonitrile (PubChem CID 115337642) has the molecular formula C11H13NO2S2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1,1-dioxo-3-(2-thiophen-3-ylethyl)thiolane-3-carbonitrile.
| Compound Name | 1,1-dioxo-3-(2-thiophen-3-ylethyl)thiolane-3-carbonitrile |
|---|---|
| PubChem CID | 115337642 |
| Molecular Formula | C11H13NO2S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 1,1-dioxo-3-(2-thiophen-3-ylethyl)thiolane-3-carbonitrile |
| SMILES | N#CC1(CCc2ccsc2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13NO2S2/c12-8-11(4-6-16(13,14)9-11)3-1-10-2-5-15-7-10/h2,5,7H,1,3-4,6,9H2 |
| InChIKey | CACNWQCCGCQSED-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |