C10H15NO2S2 — CID 78992067
[1,1-dioxo-3-(thiophen-3-ylmethyl)thiolan-3-yl]methanamine (PubChem CID 78992067) has the molecular formula C10H15NO2S2 and a molecular weight of 245.37 g/mol. Its IUPAC name is [1,1-dioxo-3-(thiophen-3-ylmethyl)thiolan-3-yl]methanamine.
| Compound Name | [1,1-dioxo-3-(thiophen-3-ylmethyl)thiolan-3-yl]methanamine |
|---|---|
| PubChem CID | 78992067 |
| Molecular Formula | C10H15NO2S2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | [1,1-dioxo-3-(thiophen-3-ylmethyl)thiolan-3-yl]methanamine |
| SMILES | NCC1(Cc2ccsc2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15NO2S2/c11-7-10(2-4-15(12,13)8-10)5-9-1-3-14-6-9/h1,3,6H,2,4-5,7-8,11H2 |
| InChIKey | CXOXDKVQBRRJQV-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |