C12H13N3O — CID 115340174
3-[(E)-2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethenyl]aniline (PubChem CID 115340174) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 3-[(E)-2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethenyl]aniline.
| Compound Name | 3-[(E)-2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 115340174 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-[(E)-2-(3-ethyl-1,2,4-oxadiazol-5-yl)ethenyl]aniline |
| SMILES | CCc1noc(/C=C/c2cccc(N)c2)n1 |
| InChI | InChI=1S/C12H13N3O/c1-2-11-14-12(16-15-11)7-6-9-4-3-5-10(13)8-9/h3-8H,2,13H2,1H3/b7-6+ |
| InChIKey | NPTGMEBCKUOGOE-VOTSOKGWSA-N |
| XLogP | 2.38 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|