C15H15N3O3 — CID 115341445
5-[3-(4-aminophenyl)propanoylamino]pyridine-3-carboxylic acid (PubChem CID 115341445) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 5-[3-(4-aminophenyl)propanoylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-[3-(4-aminophenyl)propanoylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 115341445 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 5-[3-(4-aminophenyl)propanoylamino]pyridine-3-carboxylic acid |
| SMILES | Nc1ccc(CCC(=O)Nc2cncc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C15H15N3O3/c16-12-4-1-10(2-5-12)3-6-14(19)18-13-7-11(15(20)21)8-17-9-13/h1-2,4-5,7-9H,3,6,16H2,(H,18,19)(H,20,21) |
| InChIKey | RPLXWLPZWZOXRL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|