C15H24N2O — CID 115341975
3-[3-(oxan-2-ylmethylamino)propyl]aniline (PubChem CID 115341975) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-[3-(oxan-2-ylmethylamino)propyl]aniline.
| Compound Name | 3-[3-(oxan-2-ylmethylamino)propyl]aniline |
|---|---|
| PubChem CID | 115341975 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 3-[3-(oxan-2-ylmethylamino)propyl]aniline |
| SMILES | Nc1cccc(CCCNCC2CCCCO2)c1 |
| InChI | InChI=1S/C15H24N2O/c16-14-7-3-5-13(11-14)6-4-9-17-12-15-8-1-2-10-18-15/h3,5,7,11,15,17H,1-2,4,6,8-10,12,16H2 |
| InChIKey | ZHQWDNCRUHHLDX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|