C19H24N2 — CID 115342191
3-[3-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)propyl]aniline (PubChem CID 115342191) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 3-[3-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)propyl]aniline.
| Compound Name | 3-[3-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)propyl]aniline |
|---|---|
| PubChem CID | 115342191 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 3-[3-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)propyl]aniline |
| SMILES | Nc1cccc(CCCN2CCCCc3ccccc32)c1 |
| InChI | InChI=1S/C19H24N2/c20-18-11-5-7-16(15-18)8-6-14-21-13-4-3-10-17-9-1-2-12-19(17)21/h1-2,5,7,9,11-12,15H,3-4,6,8,10,13-14,20H2 |
| InChIKey | MPUQYJVXCKCAKF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|